C21H28ClNO3 — CID 17331161
ethyl 4-[5-[(cycloheptylamino)methyl]furan-2-yl]benzoate;hydrochloride (PubChem CID 17331161) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is ethyl 4-[5-[(cycloheptylamino)methyl]furan-2-yl]benzoate;hydrochloride.
| Compound Name | ethyl 4-[5-[(cycloheptylamino)methyl]furan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 17331161 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | ethyl 4-[5-[(cycloheptylamino)methyl]furan-2-yl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(-c2ccc(CNC3CCCCCC3)o2)cc1.Cl |
| InChI | InChI=1S/C21H27NO3.ClH/c1-2-24-21(23)17-11-9-16(10-12-17)20-14-13-19(25-20)15-22-18-7-5-3-4-6-8-18;/h9-14,18,22H,2-8,15H2,1H3;1H |
| InChIKey | KULBAXVEOCSVIU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |