C20H30Cl2N2O3 — CID 17331159
ethyl 4-[5-[[2-(diethylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride (PubChem CID 17331159) has the molecular formula C20H30Cl2N2O3 and a molecular weight of 417.38 g/mol. Its IUPAC name is ethyl 4-[5-[[2-(diethylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride.
| Compound Name | ethyl 4-[5-[[2-(diethylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 17331159 |
| Molecular Formula | C20H30Cl2N2O3 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 4-[5-[[2-(diethylamino)ethylamino]methyl]furan-2-yl]benzoate;dihydrochloride |
| SMILES | CCOC(=O)c1ccc(-c2ccc(CNCCN(CC)CC)o2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H28N2O3.2ClH/c1-4-22(5-2)14-13-21-15-18-11-12-19(25-18)16-7-9-17(10-8-16)20(23)24-6-3;;/h7-12,21H,4-6,13-15H2,1-3H3;2*1H |
| InChIKey | NACQHROHWGLWPV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|