C15H18ClNO4 — CID 17332782
methyl 4-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]benzoate;hydrochloride (PubChem CID 17332782) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is methyl 4-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 17332782 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 4-[5-[(2-hydroxyethylamino)methyl]furan-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(-c2ccc(CNCCO)o2)cc1.Cl |
| InChI | InChI=1S/C15H17NO4.ClH/c1-19-15(18)12-4-2-11(3-5-12)14-7-6-13(20-14)10-16-8-9-17;/h2-7,16-17H,8-10H2,1H3;1H |
| InChIKey | MIFXALOWJGTTFE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|