C21H22ClNO4 — CID 17332933
methyl 4-[5-[[(4-methoxyphenyl)methylamino]methyl]furan-2-yl]benzoate;hydrochloride (PubChem CID 17332933) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is methyl 4-[5-[[(4-methoxyphenyl)methylamino]methyl]furan-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[5-[[(4-methoxyphenyl)methylamino]methyl]furan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 17332933 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | methyl 4-[5-[[(4-methoxyphenyl)methylamino]methyl]furan-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(-c2ccc(CNCc3ccc(OC)cc3)o2)cc1.Cl |
| InChI | InChI=1S/C21H21NO4.ClH/c1-24-18-9-3-15(4-10-18)13-22-14-19-11-12-20(26-19)16-5-7-17(8-6-16)21(23)25-2;/h3-12,22H,13-14H2,1-2H3;1H |
| InChIKey | DYUCWDDOJAKVLG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |