C19H19ClN2O3 — CID 17332875
methyl 4-[5-[(pyridin-4-ylmethylamino)methyl]furan-2-yl]benzoate;hydrochloride (PubChem CID 17332875) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is methyl 4-[5-[(pyridin-4-ylmethylamino)methyl]furan-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[5-[(pyridin-4-ylmethylamino)methyl]furan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 17332875 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 4-[5-[(pyridin-4-ylmethylamino)methyl]furan-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(-c2ccc(CNCc3ccncc3)o2)cc1.Cl |
| InChI | InChI=1S/C19H18N2O3.ClH/c1-23-19(22)16-4-2-15(3-5-16)18-7-6-17(24-18)13-21-12-14-8-10-20-11-9-14;/h2-11,21H,12-13H2,1H3;1H |
| InChIKey | JLWAZEDIFIYXAW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |