C19H17ClFNO3 — CID 17056095
4-[5-[[(4-fluorophenyl)methylamino]methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17056095) has the molecular formula C19H17ClFNO3 and a molecular weight of 361.80 g/mol. Its IUPAC name is 4-[5-[[(4-fluorophenyl)methylamino]methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 4-[5-[[(4-fluorophenyl)methylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17056095 |
| Molecular Formula | C19H17ClFNO3 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-[5-[[(4-fluorophenyl)methylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ccc(CNCc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C19H16FNO3.ClH/c20-16-7-1-13(2-8-16)11-21-12-17-9-10-18(24-17)14-3-5-15(6-4-14)19(22)23;/h1-10,21H,11-12H2,(H,22,23);1H |
| InChIKey | QQUYQPFZZXANMK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |