C17H16ClNO4 — CID 17056129
4-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17056129) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 4-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 4-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17056129 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-[5-[(furan-2-ylmethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ccc(CNCc3ccco3)o2)cc1 |
| InChI | InChI=1S/C17H15NO4.ClH/c19-17(20)13-5-3-12(4-6-13)16-8-7-15(22-16)11-18-10-14-2-1-9-21-14;/h1-9,18H,10-11H2,(H,19,20);1H |
| InChIKey | ZOLCLDZNGZVYSY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |