C22H21ClN2O3 — CID 17056105
4-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17056105) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 4-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 4-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17056105 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ccc(CNCCc3c[nH]c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C22H20N2O3.ClH/c25-22(26)16-7-5-15(6-8-16)21-10-9-18(27-21)14-23-12-11-17-13-24-20-4-2-1-3-19(17)20;/h1-10,13,23-24H,11-12,14H2,(H,25,26);1H |
| InChIKey | LBHKNCMEIDITKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|