C25H25ClN2O5 — CID 17333476
dimethyl 5-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride (PubChem CID 17333476) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is dimethyl 5-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride.
| Compound Name | dimethyl 5-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 17333476 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | dimethyl 5-[5-[[2-(1H-indol-3-yl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(CNCCc3c[nH]c4ccccc34)o2)c1.Cl |
| InChI | InChI=1S/C25H24N2O5.ClH/c1-30-24(28)18-11-17(12-19(13-18)25(29)31-2)23-8-7-20(32-23)15-26-10-9-16-14-27-22-6-4-3-5-21(16)22;/h3-8,11-14,26-27H,9-10,15H2,1-2H3;1H |
| InChIKey | QXOUUPYGNGDVOF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|