C21H28Cl2N2O6 — CID 17333473
dimethyl 5-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]benzene-1,3-dicarboxylate;dihydrochloride (PubChem CID 17333473) has the molecular formula C21H28Cl2N2O6 and a molecular weight of 475.37 g/mol. Its IUPAC name is dimethyl 5-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]benzene-1,3-dicarboxylate;dihydrochloride.
| Compound Name | dimethyl 5-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]benzene-1,3-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 17333473 |
| Molecular Formula | C21H28Cl2N2O6 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | dimethyl 5-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]benzene-1,3-dicarboxylate;dihydrochloride |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(CNCCN3CCOCC3)o2)c1.Cl.Cl |
| InChI | InChI=1S/C21H26N2O6.2ClH/c1-26-20(24)16-11-15(12-17(13-16)21(25)27-2)19-4-3-18(29-19)14-22-5-6-23-7-9-28-10-8-23;;/h3-4,11-13,22H,5-10,14H2,1-2H3;2*1H |
| InChIKey | KPRYGMSSKNFZCZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|