C19H28Cl2N2O3 — CID 17333534
1-[4-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]phenyl]ethanol;dihydrochloride (PubChem CID 17333534) has the molecular formula C19H28Cl2N2O3 and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-[4-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]phenyl]ethanol;dihydrochloride.
| Compound Name | 1-[4-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]phenyl]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17333534 |
| Molecular Formula | C19H28Cl2N2O3 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[4-[5-[(2-morpholin-4-ylethylamino)methyl]furan-2-yl]phenyl]ethanol;dihydrochloride |
| SMILES | CC(O)c1ccc(-c2ccc(CNCCN3CCOCC3)o2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H26N2O3.2ClH/c1-15(22)16-2-4-17(5-3-16)19-7-6-18(24-19)14-20-8-9-21-10-12-23-13-11-21;;/h2-7,15,20,22H,8-14H2,1H3;2*1H |
| InChIKey | AGWHQJFNJZRYBV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|