C16H22ClNO3 — CID 17333543
1-[4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]phenyl]ethanol;hydrochloride (PubChem CID 17333543) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-[4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]phenyl]ethanol;hydrochloride.
| Compound Name | 1-[4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17333543 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[4-[5-[(2-methoxyethylamino)methyl]furan-2-yl]phenyl]ethanol;hydrochloride |
| SMILES | COCCNCc1ccc(-c2ccc(C(C)O)cc2)o1.Cl |
| InChI | InChI=1S/C16H21NO3.ClH/c1-12(18)13-3-5-14(6-4-13)16-8-7-15(20-16)11-17-9-10-19-2;/h3-8,12,17-18H,9-11H2,1-2H3;1H |
| InChIKey | YXQDEYUXKQCKSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|