C15H17Cl2NO4 — CID 132897703
2-chloro-5-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 132897703) has the molecular formula C15H17Cl2NO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-chloro-5-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 2-chloro-5-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 132897703 |
| Molecular Formula | C15H17Cl2NO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-chloro-5-[5-[(2-methoxyethylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | COCCNCc1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1.Cl |
| InChI | InChI=1S/C15H16ClNO4.ClH/c1-20-7-6-17-9-11-3-5-14(21-11)10-2-4-13(16)12(8-10)15(18)19;/h2-5,8,17H,6-7,9H2,1H3,(H,18,19);1H |
| InChIKey | XBHMLYZLKYKPEX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|