C16H21Cl2NO3 — CID 17156649
2-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylamino]ethoxy]ethanol;hydrochloride (PubChem CID 17156649) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylamino]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylamino]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17156649 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[2-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylamino]ethoxy]ethanol;hydrochloride |
| SMILES | Cc1ccc(-c2ccc(CNCCOCCO)o2)cc1Cl.Cl |
| InChI | InChI=1S/C16H20ClNO3.ClH/c1-12-2-3-13(10-15(12)17)16-5-4-14(21-16)11-18-6-8-20-9-7-19;/h2-5,10,18-19H,6-9,11H2,1H3;1H |
| InChIKey | RJSZITYDFVPGMD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|