C19H27Cl2NO — CID 17057126
N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]heptan-1-amine;hydrochloride (PubChem CID 17057126) has the molecular formula C19H27Cl2NO and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17057126 |
| Molecular Formula | C19H27Cl2NO |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1ccc(-c2ccc(C)c(Cl)c2)o1.Cl |
| InChI | InChI=1S/C19H26ClNO.ClH/c1-3-4-5-6-7-12-21-14-17-10-11-19(22-17)16-9-8-15(2)18(20)13-16;/h8-11,13,21H,3-7,12,14H2,1-2H3;1H |
| InChIKey | MIVPRDYSQHZGFW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|