C14H16Cl3NO — CID 17332122
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride (PubChem CID 17332122) has the molecular formula C14H16Cl3NO and a molecular weight of 320.65 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17332122 |
| Molecular Formula | C14H16Cl3NO |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1ccc(-c2cc(Cl)cc(Cl)c2)o1.Cl |
| InChI | InChI=1S/C14H15Cl2NO.ClH/c1-2-5-17-9-13-3-4-14(18-13)10-6-11(15)8-12(16)7-10;/h3-4,6-8,17H,2,5,9H2,1H3;1H |
| InChIKey | QSLZYQXRQONWET-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|