C14H13Cl2NO — CID 4723665
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]prop-2-en-1-amine (PubChem CID 4723665) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 4723665 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C14H13Cl2NO/c1-2-5-17-9-13-3-4-14(18-13)10-6-11(15)8-12(16)7-10/h2-4,6-8,17H,1,5,9H2 |
| InChIKey | GKTHMXJTZONCPQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|