C15H15Cl2NO3 — CID 17212943
4-chloro-3-[5-[(prop-2-enylamino)methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17212943) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is 4-chloro-3-[5-[(prop-2-enylamino)methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 4-chloro-3-[5-[(prop-2-enylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17212943 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-chloro-3-[5-[(prop-2-enylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | C=CCNCc1ccc(-c2cc(C(=O)O)ccc2Cl)o1.Cl |
| InChI | InChI=1S/C15H14ClNO3.ClH/c1-2-7-17-9-11-4-6-14(20-11)12-8-10(15(18)19)3-5-13(12)16;/h2-6,8,17H,1,7,9H2,(H,18,19);1H |
| InChIKey | XJFUDCCBQPUOLJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|