C18H21Cl2NO3 — CID 17212895
4-chloro-3-[5-[(cyclohexylamino)methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17212895) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is 4-chloro-3-[5-[(cyclohexylamino)methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 4-chloro-3-[5-[(cyclohexylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17212895 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-chloro-3-[5-[(cyclohexylamino)methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(Cl)c(-c2ccc(CNC3CCCCC3)o2)c1 |
| InChI | InChI=1S/C18H20ClNO3.ClH/c19-16-8-6-12(18(21)22)10-15(16)17-9-7-14(23-17)11-20-13-4-2-1-3-5-13;/h6-10,13,20H,1-5,11H2,(H,21,22);1H |
| InChIKey | FSCPMDQACOOKNW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |