C23H33ClN2O3 — CID 17214899
4-chloro-3-[5-[[3-(dibutylamino)propylamino]methyl]furan-2-yl]benzoic acid (PubChem CID 17214899) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is 4-chloro-3-[5-[[3-(dibutylamino)propylamino]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[[3-(dibutylamino)propylamino]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 17214899 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-chloro-3-[5-[[3-(dibutylamino)propylamino]methyl]furan-2-yl]benzoic acid |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(-c2cc(C(=O)O)ccc2Cl)o1 |
| InChI | InChI=1S/C23H33ClN2O3/c1-3-5-13-26(14-6-4-2)15-7-12-25-17-19-9-11-22(29-19)20-16-18(23(27)28)8-10-21(20)24/h8-11,16,25H,3-7,12-15,17H2,1-2H3,(H,27,28) |
| InChIKey | XTRABOYUUQGRBA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|