C15H18BrCl2NO — CID 17056161
N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]butan-1-amine;hydrochloride (PubChem CID 17056161) has the molecular formula C15H18BrCl2NO and a molecular weight of 379.13 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17056161 |
| Molecular Formula | C15H18BrCl2NO |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1ccc(-c2ccc(Br)cc2Cl)o1.Cl |
| InChI | InChI=1S/C15H17BrClNO.ClH/c1-2-3-8-18-10-12-5-7-15(19-12)13-6-4-11(16)9-14(13)17;/h4-7,9,18H,2-3,8,10H2,1H3;1H |
| InChIKey | KEVGVTBAYVDBMG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|