C16H22BrCl3N2O2 — CID 17056230
1-[2-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methylamino]ethylamino]propan-2-ol;dihydrochloride (PubChem CID 17056230) has the molecular formula C16H22BrCl3N2O2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-[2-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methylamino]ethylamino]propan-2-ol;dihydrochloride.
| Compound Name | 1-[2-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 17056230 |
| Molecular Formula | C16H22BrCl3N2O2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 1-[2-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
| SMILES | CC(O)CNCCNCc1ccc(-c2ccc(Br)cc2Cl)o1.Cl.Cl |
| InChI | InChI=1S/C16H20BrClN2O2.2ClH/c1-11(21)9-19-6-7-20-10-13-3-5-16(22-13)14-4-2-12(17)8-15(14)18;;/h2-5,8,11,19-21H,6-7,9-10H2,1H3;2*1H |
| InChIKey | VCZPVIJEZZPDDC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|