C17H21Br2NO2 — CID 17209187
N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 17209187) has the molecular formula C17H21Br2NO2 and a molecular weight of 431.17 g/mol. Its IUPAC name is N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 17209187 |
| Molecular Formula | C17H21Br2NO2 |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | CC(C)OCCCNCc1ccc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C17H21Br2NO2/c1-12(2)21-9-3-8-20-11-14-5-7-17(22-14)15-6-4-13(18)10-16(15)19/h4-7,10,12,20H,3,8-9,11H2,1-2H3 |
| InChIKey | VTZATVLUNJNGLW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|