C21H22BrCl2NO — CID 17211415
N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride (PubChem CID 17211415) has the molecular formula C21H22BrCl2NO and a molecular weight of 455.22 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride.
| Compound Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17211415 |
| Molecular Formula | C21H22BrCl2NO |
| Molecular Weight | 455.22 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride |
| SMILES | CC(CCc1ccccc1)NCc1ccc(-c2ccc(Br)cc2Cl)o1.Cl |
| InChI | InChI=1S/C21H21BrClNO.ClH/c1-15(7-8-16-5-3-2-4-6-16)24-14-18-10-12-21(25-18)19-11-9-17(22)13-20(19)23;/h2-6,9-13,15,24H,7-8,14H2,1H3;1H |
| InChIKey | ZNXDQBQUEYXHDN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.22 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |