C15H17Br2NO — CID 62084806
N-[(4,5-dibromofuran-2-yl)methyl]-4-phenylbutan-2-amine (PubChem CID 62084806) has the molecular formula C15H17Br2NO and a molecular weight of 387.12 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-4-phenylbutan-2-amine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 62084806 |
| Molecular Formula | C15H17Br2NO |
| Molecular Weight | 387.12 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-4-phenylbutan-2-amine |
| SMILES | CC(CCc1ccccc1)NCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C15H17Br2NO/c1-11(7-8-12-5-3-2-4-6-12)18-10-13-9-14(16)15(17)19-13/h2-6,9,11,18H,7-8,10H2,1H3 |
| InChIKey | CYHYTZAWZVCRES-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |