C22H24ClNO2 — CID 17211376
N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine (PubChem CID 17211376) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine.
| Compound Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 17211376 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine |
| SMILES | COc1ccc(-c2ccc(CNC(C)CCc3ccccc3)o2)cc1Cl |
| InChI | InChI=1S/C22H24ClNO2/c1-16(8-9-17-6-4-3-5-7-17)24-15-19-11-13-21(26-19)18-10-12-22(25-2)20(23)14-18/h3-7,10-14,16,24H,8-9,15H2,1-2H3 |
| InChIKey | RPPVPKWZQAOXSD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |