C19H17BrClNO2 — CID 17208292
N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine (PubChem CID 17208292) has the molecular formula C19H17BrClNO2 and a molecular weight of 406.71 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17208292 |
| Molecular Formula | C19H17BrClNO2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-[[5-(4-bromo-2-chlorophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CNCc1ccc(-c2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C19H17BrClNO2/c1-23-18-5-3-2-4-13(18)11-22-12-15-7-9-19(24-15)16-8-6-14(20)10-17(16)21/h2-10,22H,11-12H2,1H3 |
| InChIKey | LNCOSPPPLGGSQB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |