C13H13ClFNO — CID 43624793
N-[[5-(2-chloro-4-fluorophenyl)furan-2-yl]methyl]ethanamine (PubChem CID 43624793) has the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. Its IUPAC name is N-[[5-(2-chloro-4-fluorophenyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2-chloro-4-fluorophenyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 43624793 |
| Molecular Formula | C13H13ClFNO |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[[5-(2-chloro-4-fluorophenyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc(-c2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C13H13ClFNO/c1-2-16-8-10-4-6-13(17-10)11-5-3-9(15)7-12(11)14/h3-7,16H,2,8H2,1H3 |
| InChIKey | LCITXQYWCZYXCD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |