C17H12Cl2FNO — CID 1446213
N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4-fluoroaniline (PubChem CID 1446213) has the molecular formula C17H12Cl2FNO and a molecular weight of 336.19 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4-fluoroaniline.
| Compound Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 1446213 |
| Molecular Formula | C17H12Cl2FNO |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4-fluoroaniline |
| SMILES | Fc1ccc(NCc2ccc(-c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C17H12Cl2FNO/c18-11-1-7-15(16(19)9-11)17-8-6-14(22-17)10-21-13-4-2-12(20)3-5-13/h1-9,21H,10H2 |
| InChIKey | ORQZDNLVAHAGGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |