C18H10Cl3F2NO2 — CID 2174440
2-chloro-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4,5-difluorobenzamide (PubChem CID 2174440) has the molecular formula C18H10Cl3F2NO2 and a molecular weight of 416.64 g/mol. Its IUPAC name is 2-chloro-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 2174440 |
| Molecular Formula | C18H10Cl3F2NO2 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 2-chloro-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-4,5-difluorobenzamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Cl)cc2Cl)o1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H10Cl3F2NO2/c19-9-1-3-11(13(20)5-9)17-4-2-10(26-17)8-24-18(25)12-6-15(22)16(23)7-14(12)21/h1-7H,8H2,(H,24,25) |
| InChIKey | OXPHKXWPCPKPIA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|