C16H15Cl2N5O3 — CID 4724324
4-amino-N-[2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 4724324) has the molecular formula C16H15Cl2N5O3 and a molecular weight of 396.23 g/mol. Its IUPAC name is 4-amino-N-[2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 4724324 |
| Molecular Formula | C16H15Cl2N5O3 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-amino-N-[2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNCc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C16H15Cl2N5O3/c17-9-1-3-11(12(18)7-9)13-4-2-10(25-13)8-20-5-6-21-16(24)14-15(19)23-26-22-14/h1-4,7,20H,5-6,8H2,(H2,19,23)(H,21,24) |
| InChIKey | CILOKCNWEDIIHX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|