C12H14Cl2N5O2+ — CID 7248537
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[(2,4-dichlorophenyl)methyl]azanium (PubChem CID 7248537) has the molecular formula C12H14Cl2N5O2+ and a molecular weight of 331.18 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[(2,4-dichlorophenyl)methyl]azanium.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[(2,4-dichlorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7248537 |
| Molecular Formula | C12H14Cl2N5O2+ |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[(2,4-dichlorophenyl)methyl]azanium |
| SMILES | Nc1nonc1C(=O)NCC[NH2+]Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N5O2/c13-8-2-1-7(9(14)5-8)6-16-3-4-17-12(20)10-11(15)19-21-18-10/h1-2,5,16H,3-4,6H2,(H2,15,19)(H,17,20)/p+1 |
| InChIKey | RUNRPYGURQVBAN-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|