C14H18Cl2N5O4- — CID 21233297
4-amino-N-[2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride (PubChem CID 21233297) has the molecular formula C14H18Cl2N5O4- and a molecular weight of 391.24 g/mol. Its IUPAC name is 4-amino-N-[2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride.
| Compound Name | 4-amino-N-[2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride |
|---|---|
| PubChem CID | 21233297 |
| Molecular Formula | C14H18Cl2N5O4- |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-amino-N-[2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride |
| SMILES | COc1cc(CNCCNC(=O)c2nonc2N)cc(Cl)c1OC.[Cl-] |
| InChI | InChI=1S/C14H18ClN5O4.ClH/c1-22-10-6-8(5-9(15)12(10)23-2)7-17-3-4-18-14(21)11-13(16)20-24-19-11;/h5-6,17H,3-4,7H2,1-2H3,(H2,16,20)(H,18,21);1H/p-1 |
| InChIKey | SVAXRHOFHVZKPQ-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|