C15H22ClN5O5 — CID 17293352
4-amino-N-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride (PubChem CID 17293352) has the molecular formula C15H22ClN5O5 and a molecular weight of 387.82 g/mol. Its IUPAC name is 4-amino-N-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 17293352 |
| Molecular Formula | C15H22ClN5O5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-amino-N-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
| SMILES | COc1cc(CNCCNC(=O)c2nonc2N)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C15H21N5O5.ClH/c1-22-10-6-9(7-11(23-2)13(10)24-3)8-17-4-5-18-15(21)12-14(16)20-25-19-12;/h6-7,17H,4-5,8H2,1-3H3,(H2,16,20)(H,18,21);1H |
| InChIKey | JYADLCMBYCIXAC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|