C16H22ClN5O4 — CID 66530843
4-amino-N-[2-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 66530843) has the molecular formula C16H22ClN5O4 and a molecular weight of 383.84 g/mol. Its IUPAC name is 4-amino-N-[2-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 66530843 |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-amino-N-[2-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1cc(CNCCNC(=O)c2nonc2N)c(Cl)cc1OC(C)C |
| InChI | InChI=1S/C16H22ClN5O4/c1-9(2)25-13-7-11(17)10(6-12(13)24-3)8-19-4-5-20-16(23)14-15(18)22-26-21-14/h6-7,9,19H,4-5,8H2,1-3H3,(H2,18,22)(H,20,23) |
| InChIKey | LBYMSUQWWRCNRL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|