C23H21Cl2N5O3 — CID 4718297
4-amino-N-[2-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 4718297) has the molecular formula C23H21Cl2N5O3 and a molecular weight of 486.36 g/mol. Its IUPAC name is 4-amino-N-[2-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 4718297 |
| Molecular Formula | C23H21Cl2N5O3 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-amino-N-[2-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNCc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C23H21Cl2N5O3/c24-16-7-5-15(19(25)11-16)13-32-20-8-6-14-3-1-2-4-17(14)18(20)12-27-9-10-28-23(31)21-22(26)30-33-29-21/h1-8,11,27H,9-10,12-13H2,(H2,26,30)(H,28,31) |
| InChIKey | XBIPXCRQYYURAD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|