C23H26Cl3NO2 — CID 17211551
5-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211551) has the molecular formula C23H26Cl3NO2 and a molecular weight of 454.83 g/mol. Its IUPAC name is 5-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211551 |
| Molecular Formula | C23H26Cl3NO2 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 5-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]pentan-1-ol;hydrochloride |
| SMILES | Cl.OCCCCCNCc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C23H25Cl2NO2.ClH/c24-19-10-8-18(22(25)14-19)16-28-23-11-9-17-6-2-3-7-20(17)21(23)15-26-12-4-1-5-13-27;/h2-3,6-11,14,26-27H,1,4-5,12-13,15-16H2;1H |
| InChIKey | UDRCPZGOXMFPJY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|