C21H22Cl3NO2 — CID 17294824
N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-2-methoxyethanamine;hydrochloride (PubChem CID 17294824) has the molecular formula C21H22Cl3NO2 and a molecular weight of 426.77 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-2-methoxyethanamine;hydrochloride.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-2-methoxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 17294824 |
| Molecular Formula | C21H22Cl3NO2 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-2-methoxyethanamine;hydrochloride |
| SMILES | COCCNCc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12.Cl |
| InChI | InChI=1S/C21H21Cl2NO2.ClH/c1-25-11-10-24-13-19-18-5-3-2-4-15(18)7-9-21(19)26-14-16-6-8-17(22)12-20(16)23;/h2-9,12,24H,10-11,13-14H2,1H3;1H |
| InChIKey | YIQJSMVQEJICAH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|