C24H27Cl2NO2 — CID 17208850
N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 17208850) has the molecular formula C24H27Cl2NO2 and a molecular weight of 432.39 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 17208850 |
| Molecular Formula | C24H27Cl2NO2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | CC(C)OCCCNCc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C24H27Cl2NO2/c1-17(2)28-13-5-12-27-15-22-21-7-4-3-6-18(21)9-11-24(22)29-16-19-8-10-20(25)14-23(19)26/h3-4,6-11,14,17,27H,5,12-13,15-16H2,1-2H3 |
| InChIKey | QAJLAYHCDDVNFW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|