C19H23ClFNO2 — CID 66530881
N-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 66530881) has the molecular formula C19H23ClFNO2 and a molecular weight of 351.85 g/mol. Its IUPAC name is N-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66530881 |
| Molecular Formula | C19H23ClFNO2 |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[(2-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | COc1cc(CNCCc2ccccc2F)c(Cl)cc1OC(C)C |
| InChI | InChI=1S/C19H23ClFNO2/c1-13(2)24-19-11-16(20)15(10-18(19)23-3)12-22-9-8-14-6-4-5-7-17(14)21/h4-7,10-11,13,22H,8-9,12H2,1-3H3 |
| InChIKey | LEPXRKPQSYTGGY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|