C19H22BrCl2NO2 — CID 66535631
N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 66535631) has the molecular formula C19H22BrCl2NO2 and a molecular weight of 447.20 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66535631 |
| Molecular Formula | C19H22BrCl2NO2 |
| Molecular Weight | 447.20 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2Cl)c(Br)cc1OC(C)C |
| InChI | InChI=1S/C19H22BrCl2NO2/c1-12(2)25-19-10-16(20)14(8-18(19)24-3)11-23-7-6-13-4-5-15(21)9-17(13)22/h4-5,8-10,12,23H,6-7,11H2,1-3H3 |
| InChIKey | RUWIKYMYJLSKQX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.20 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|