C21H25BrN2O2 — CID 66535530
N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 66535530) has the molecular formula C21H25BrN2O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 66535530 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | COc1cc(CNCCc2c[nH]c3ccccc23)c(Br)cc1OC(C)C |
| InChI | InChI=1S/C21H25BrN2O2/c1-14(2)26-21-11-18(22)16(10-20(21)25-3)12-23-9-8-15-13-24-19-7-5-4-6-17(15)19/h4-7,10-11,13-14,23-24H,8-9,12H2,1-3H3 |
| InChIKey | VUOANDLABSJANA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|