C21H26N2O3 — CID 119106557
N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 119106557) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 119106557 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | CCOc1c(OC)cc(CNCCc2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C21H26N2O3/c1-4-26-21-19(24-2)11-15(12-20(21)25-3)13-22-10-9-16-14-23-18-8-6-5-7-17(16)18/h5-8,11-12,14,22-23H,4,9-10,13H2,1-3H3 |
| InChIKey | YSVDTDHRCSAMCE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|