C21H26Cl2N2O2 — CID 163332931
N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride (PubChem CID 163332931) has the molecular formula C21H26Cl2N2O2 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 163332931 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)cc(Cl)c1OCC.Cl |
| InChI | InChI=1S/C21H25ClN2O2.ClH/c1-3-25-20-12-15(11-18(22)21(20)26-4-2)13-23-10-9-16-14-24-19-8-6-5-7-17(16)19;/h5-8,11-12,14,23-24H,3-4,9-10,13H2,1-2H3;1H |
| InChIKey | JYRSDOHKEUPMNL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|