C26H27BrClFN2O2 — CID 17295190
N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride (PubChem CID 17295190) has the molecular formula C26H27BrClFN2O2 and a molecular weight of 533.87 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295190 |
| Molecular Formula | C26H27BrClFN2O2 |
| Molecular Weight | 533.87 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)cc(Br)c1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C26H26BrFN2O2.ClH/c1-2-31-25-14-19(13-23(27)26(25)32-17-18-7-9-21(28)10-8-18)15-29-12-11-20-16-30-24-6-4-3-5-22(20)24;/h3-10,13-14,16,29-30H,2,11-12,15,17H2,1H3;1H |
| InChIKey | KQOLNXNIZJBPRI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|