C25H25BrFN3O2 — CID 66527042
2-(1H-benzimidazol-2-yl)-N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine (PubChem CID 66527042) has the molecular formula C25H25BrFN3O2 and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66527042 |
| Molecular Formula | C25H25BrFN3O2 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]ethanamine |
| SMILES | CCOc1cc(CNCCc2nc3ccccc3[nH]2)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H25BrFN3O2/c1-2-31-23-14-18(13-20(26)25(23)32-16-17-7-9-19(27)10-8-17)15-28-12-11-24-29-21-5-3-4-6-22(21)30-24/h3-10,13-14,28H,2,11-12,15-16H2,1H3,(H,29,30) |
| InChIKey | HIIPKIXSOMKVPP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|