C26H25BrCl2N2O2 — CID 4720642
N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 4720642) has the molecular formula C26H25BrCl2N2O2 and a molecular weight of 548.31 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 4720642 |
| Molecular Formula | C26H25BrCl2N2O2 |
| Molecular Weight | 548.31 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25BrCl2N2O2/c1-2-32-25-12-17(14-30-10-9-18-15-31-24-6-4-3-5-21(18)24)11-22(27)26(25)33-16-19-7-8-20(28)13-23(19)29/h3-8,11-13,15,30-31H,2,9-10,14,16H2,1H3 |
| InChIKey | DEVGBEHIKUZUCR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.31 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|