C20H23Cl2N2O2- — CID 53351006
N-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine chloride (PubChem CID 53351006) has the molecular formula C20H23Cl2N2O2- and a molecular weight of 394.32 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine chloride.
| Compound Name | N-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine chloride |
|---|---|
| PubChem CID | 53351006 |
| Molecular Formula | C20H23Cl2N2O2- |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine chloride |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)cc(Cl)c1OC.[Cl-] |
| InChI | InChI=1S/C20H23ClN2O2.ClH/c1-3-25-19-11-14(10-17(21)20(19)24-2)12-22-9-8-15-13-23-18-7-5-4-6-16(15)18;/h4-7,10-11,13,22-23H,3,8-9,12H2,1-2H3;1H/p-1 |
| InChIKey | PNYISJCLVGNXHE-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|