C26H27ClN2O2 — CID 66530752
N-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 66530752) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 66530752 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-2-30-25-14-21(23(27)15-26(25)31-18-19-8-4-3-5-9-19)16-28-13-12-20-17-29-24-11-7-6-10-22(20)24/h3-11,14-15,17,28-29H,2,12-13,16,18H2,1H3 |
| InChIKey | ABTPGUCWDIFEJW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|