C26H26Cl2N2O2 — CID 66531250
N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 66531250) has the molecular formula C26H26Cl2N2O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 66531250 |
| Molecular Formula | C26H26Cl2N2O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | CCOc1cc(CNCCc2c[nH]c3ccccc23)c(Cl)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H26Cl2N2O2/c1-2-31-25-13-20(15-29-12-11-18-16-30-24-10-6-4-8-21(18)24)23(28)14-26(25)32-17-19-7-3-5-9-22(19)27/h3-10,13-14,16,29-30H,2,11-12,15,17H2,1H3 |
| InChIKey | QSOABRWZQNJFDO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|